About N-(2-fluoroethyl)-N,4-dimethyl-4-(4-methylphenyl)cyclohexa-1,5-dien-1-amine
N-(2-fluoroethyl)-N,4-dimethyl-4-(4-methylphenyl)cyclohexa-1,5-dien-1-amine (PubChem CID 134376348) has the molecular formula C17H22FN
and a molecular weight of 259.37 g/mol. Its IUPAC name is N-(2-fluoroethyl)-N,4-dimethyl-4-(4-methylphenyl)cyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | N-(2-fluoroethyl)-N,4-dimethyl-4-(4-methylphenyl)cyclohexa-1,5-dien-1-amine |
| PubChem CID | 134376348 |
| Molecular Formula | C17H22FN |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N-(2-fluoroethyl)-N,4-dimethyl-4-(4-methylphenyl)cyclohexa-1,5-dien-1-amine |
| SMILES | Cc1ccc(C2(C)C=CC(N(C)CCF)=CC2)cc1 |
| InChI | InChI=1S/C17H22FN/c1-14-4-6-15(7-5-14)17(2)10-8-16(9-11-17)19(3)13-12-18/h4-10H,11-13H2,1-3H3 |
| InChIKey | PTAUJEVVMGWRPN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2-fluoroethyl)-N,4-dimethyl-4-(4-methylphenyl)cyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluoroethyl)-N,4-dimethyl-4-(4-methylphenyl)cyclohexa-1,5-dien-1-amine?
The IUPAC name of N-(2-fluoroethyl)-N,4-dimethyl-4-(4-methylphenyl)cyclohexa-1,5-dien-1-amine (CID 134376348) is N-(2-fluoroethyl)-N,4-dimethyl-4-(4-methylphenyl)cyclohexa-1,5-dien-1-amine.
What is the SMILES notation for N-(2-fluoroethyl)-N,4-dimethyl-4-(4-methylphenyl)cyclohexa-1,5-dien-1-amine?
The canonical SMILES for N-(2-fluoroethyl)-N,4-dimethyl-4-(4-methylphenyl)cyclohexa-1,5-dien-1-amine is Cc1ccc(C2(C)C=CC(N(C)CCF)=CC2)cc1.
What is the InChIKey of N-(2-fluoroethyl)-N,4-dimethyl-4-(4-methylphenyl)cyclohexa-1,5-dien-1-amine?
The InChIKey is PTAUJEVVMGWRPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22FN/c1-14-4-6-15(7-5-14)17(2)10-8-16(9-11-17)19(3)13-12-18/h4-10H,11-13H2,1-3H3.
What are the key properties of N-(2-fluoroethyl)-N,4-dimethyl-4-(4-methylphenyl)cyclohexa-1,5-dien-1-amine?
N-(2-fluoroethyl)-N,4-dimethyl-4-(4-methylphenyl)cyclohexa-1,5-dien-1-amine has a molecular weight of 259.37 g/mol, XLogP of 4.00, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluoroethyl)-N,4-dimethyl-4-(4-methylphenyl)cyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 134376348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).