C37H35FN4O — CID 134376552
2-[6-[6-[2-[4-[2-(4-butoxyphenyl)ethyl]-2-ethyl-6-fluorophenyl]ethynyl]-3-pyridinyl]-3-pyridinyl]-5-methylpyrimidine (PubChem CID 134376552) has the molecular formula C37H35FN4O and a molecular weight of 570.71 g/mol. Its IUPAC name is 2-[6-[6-[2-[4-[2-(4-butoxyphenyl)ethyl]-2-ethyl-6-fluorophenyl]ethynyl]-3-pyridinyl]-3-pyridinyl]-5-methylpyrimidine.
| Compound Name | 2-[6-[6-[2-[4-[2-(4-butoxyphenyl)ethyl]-2-ethyl-6-fluorophenyl]ethynyl]-3-pyridinyl]-3-pyridinyl]-5-methylpyrimidine |
|---|---|
| PubChem CID | 134376552 |
| Molecular Formula | C37H35FN4O |
| Molecular Weight | 570.71 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | 2-[6-[6-[2-[4-[2-(4-butoxyphenyl)ethyl]-2-ethyl-6-fluorophenyl]ethynyl]-3-pyridinyl]-3-pyridinyl]-5-methylpyrimidine |
| SMILES | CCCCOc1ccc(CCc2cc(F)c(C#Cc3ccc(-c4ccc(-c5ncc(C)cn5)cn4)cn3)c(CC)c2)cc1 |
| InChI | InChI=1S/C37H35FN4O/c1-4-6-19-43-33-15-9-27(10-16-33)7-8-28-20-29(5-2)34(35(38)21-28)17-14-32-13-11-30(24-39-32)36-18-12-31(25-40-36)37-41-22-26(3)23-42-37/h9-13,15-16,18,20-25H,4-8,19H2,1-3H3 |
| InChIKey | RKAPKBJGRQLVKZ-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.71 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|