C36H32F4N2O6 — CID 134376957
3-[(2R)-5-(2,4-difluorophenyl)-7-ethoxycarbonyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-yl]propyl (2R)-5-(2,4-difluorophenyl)-2-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine-7-carboxylate (PubChem CID 134376957) has the molecular formula C36H32F4N2O6 and a molecular weight of 664.65 g/mol. Its IUPAC name is 3-[(2R)-5-(2,4-difluorophenyl)-7-ethoxycarbonyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-yl]propyl (2R)-5-(2,4-difluorophenyl)-2-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine-7-carboxylate.
| Compound Name | 3-[(2R)-5-(2,4-difluorophenyl)-7-ethoxycarbonyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-yl]propyl (2R)-5-(2,4-difluorophenyl)-2-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 134376957 |
| Molecular Formula | C36H32F4N2O6 |
| Molecular Weight | 664.65 g/mol |
| Exact Mass | 664.22 |
| IUPAC Name | 3-[(2R)-5-(2,4-difluorophenyl)-7-ethoxycarbonyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-yl]propyl (2R)-5-(2,4-difluorophenyl)-2-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine-7-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(F)cc2F)c2c(n1)O[C@@H](CCCOC(=O)c1cc(-c3ccc(F)cc3F)c3c(n1)O[C@H](C)CC3)CC2 |
| InChI | InChI=1S/C36H32F4N2O6/c1-3-45-35(43)31-17-28(24-12-8-21(38)16-30(24)40)26-13-9-22(48-34(26)42-31)5-4-14-46-36(44)32-18-27(23-11-7-20(37)15-29(23)39)25-10-6-19(2)47-33(25)41-32/h7-8,11-12,15-19,22H,3-6,9-10,13-14H2,1-2H3/t19-,22+/m1/s1 |
| InChIKey | IWTKUVZXWYJXGW-KNQAVFIVSA-N |
| XLogP | 7.59 |
| TPSA | 96.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.65 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|