About 5-chloro-1,5,6,7-tetrahydroindol-4-one
5-chloro-1,5,6,7-tetrahydroindol-4-one (PubChem CID 13437716) has the molecular formula C8H8ClNO
and a molecular weight of 169.61 g/mol. Its IUPAC name is 5-chloro-1,5,6,7-tetrahydroindol-4-one.
Molecular Properties
| Compound Name | 5-chloro-1,5,6,7-tetrahydroindol-4-one |
| PubChem CID | 13437716 |
| Molecular Formula | C8H8ClNO |
| Molecular Weight | 169.61 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | 5-chloro-1,5,6,7-tetrahydroindol-4-one |
| SMILES | O=C1c2cc[nH]c2CCC1Cl |
| InChI | InChI=1S/C8H8ClNO/c9-6-1-2-7-5(8(6)11)3-4-10-7/h3-4,6,10H,1-2H2 |
| InChIKey | ISPVHDLIYPEITN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.61 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-1,5,6,7-tetrahydroindol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,5,6,7-tetrahydroindol-4-one?
The IUPAC name of 5-chloro-1,5,6,7-tetrahydroindol-4-one (CID 13437716) is 5-chloro-1,5,6,7-tetrahydroindol-4-one.
What is the SMILES notation for 5-chloro-1,5,6,7-tetrahydroindol-4-one?
The canonical SMILES for 5-chloro-1,5,6,7-tetrahydroindol-4-one is O=C1c2cc[nH]c2CCC1Cl.
What is the InChIKey of 5-chloro-1,5,6,7-tetrahydroindol-4-one?
The InChIKey is ISPVHDLIYPEITN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNO/c9-6-1-2-7-5(8(6)11)3-4-10-7/h3-4,6,10H,1-2H2.
What are the key properties of 5-chloro-1,5,6,7-tetrahydroindol-4-one?
5-chloro-1,5,6,7-tetrahydroindol-4-one has a molecular weight of 169.61 g/mol, XLogP of 1.75, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,5,6,7-tetrahydroindol-4-one is sourced from PubChem (CID 13437716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).