About 9-methyl-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione
9-methyl-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione (PubChem CID 134377426) has the molecular formula C8H10N2S
and a molecular weight of 166.25 g/mol. Its IUPAC name is 9-methyl-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione.
Molecular Properties
| Compound Name | 9-methyl-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione |
| PubChem CID | 134377426 |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 9-methyl-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione |
| SMILES | Cc1[nH]c(=S)n2c1C1CC1C2 |
| InChI | InChI=1S/C8H10N2S/c1-4-7-6-2-5(6)3-10(7)8(11)9-4/h5-6H,2-3H2,1H3,(H,9,11) |
| InChIKey | IRIJYMLWKHFYGQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 9-methyl-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione?
The IUPAC name of 9-methyl-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione (CID 134377426) is 9-methyl-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione.
What is the SMILES notation for 9-methyl-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione?
The canonical SMILES for 9-methyl-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione is Cc1[nH]c(=S)n2c1C1CC1C2.
What is the InChIKey of 9-methyl-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione?
The InChIKey is IRIJYMLWKHFYGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2S/c1-4-7-6-2-5(6)3-10(7)8(11)9-4/h5-6H,2-3H2,1H3,(H,9,11).
What are the key properties of 9-methyl-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione?
9-methyl-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione has a molecular weight of 166.25 g/mol, XLogP of 1.97, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione is sourced from PubChem (CID 134377426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).