C21H25F3N2 — CID 134377447
(2E,4Z,6Z)-5-N-[(Z)-1-cyclopropylprop-1-enyl]-4-fluoro-1-N-[(3Z)-4-fluoro-3-(fluoromethyl)hexa-1,3-dien-5-yn-2-yl]octa-2,4,6-triene-1,5-diamine (PubChem CID 134377447) has the molecular formula C21H25F3N2 and a molecular weight of 362.44 g/mol. Its IUPAC name is (2E,4Z,6Z)-5-N-[(Z)-1-cyclopropylprop-1-enyl]-4-fluoro-1-N-[(3Z)-4-fluoro-3-(fluoromethyl)hexa-1,3-dien-5-yn-2-yl]octa-2,4,6-triene-1,5-diamine.
| Compound Name | (2E,4Z,6Z)-5-N-[(Z)-1-cyclopropylprop-1-enyl]-4-fluoro-1-N-[(3Z)-4-fluoro-3-(fluoromethyl)hexa-1,3-dien-5-yn-2-yl]octa-2,4,6-triene-1,5-diamine |
|---|---|
| PubChem CID | 134377447 |
| Molecular Formula | C21H25F3N2 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (2E,4Z,6Z)-5-N-[(Z)-1-cyclopropylprop-1-enyl]-4-fluoro-1-N-[(3Z)-4-fluoro-3-(fluoromethyl)hexa-1,3-dien-5-yn-2-yl]octa-2,4,6-triene-1,5-diamine |
| SMILES | C#C/C(F)=C(/CF)C(=C)NC/C=C/C(F)=C(\C=C/C)N/C(=C\C)C1CC1 |
| InChI | InChI=1S/C21H25F3N2/c1-5-9-21(26-20(7-3)16-11-12-16)19(24)10-8-13-25-15(4)17(14-22)18(23)6-2/h2,5,7-10,16,25-26H,4,11-14H2,1,3H3/b9-5-,10-8+,18-17+,20-7-,21-19- |
| InChIKey | JTLAZEFRNRYKOV-HBSTULCUSA-N |
| XLogP | 5.13 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|