C21H19F5N4O — CID 134377448
(2E,4Z,6Z)-N-[6-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]-6,7-difluoro-2-methylocta-2,4,6-trienamide (PubChem CID 134377448) has the molecular formula C21H19F5N4O and a molecular weight of 438.40 g/mol. Its IUPAC name is (2E,4Z,6Z)-N-[6-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]-6,7-difluoro-2-methylocta-2,4,6-trienamide.
| Compound Name | (2E,4Z,6Z)-N-[6-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]-6,7-difluoro-2-methylocta-2,4,6-trienamide |
|---|---|
| PubChem CID | 134377448 |
| Molecular Formula | C21H19F5N4O |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | (2E,4Z,6Z)-N-[6-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]-6,7-difluoro-2-methylocta-2,4,6-trienamide |
| SMILES | C/C(F)=C(F)\C=C/C=C(\C)C(=O)Nc1ccc(-n2nc(C(F)(F)F)cc2C2CC2)nc1 |
| InChI | InChI=1S/C21H19F5N4O/c1-12(4-3-5-16(23)13(2)22)20(31)28-15-8-9-19(27-11-15)30-17(14-6-7-14)10-18(29-30)21(24,25)26/h3-5,8-11,14H,6-7H2,1-2H3,(H,28,31)/b5-3-,12-4+,16-13- |
| InChIKey | UYKGYSASCSGFQB-FQKBSBLUSA-N |
| XLogP | 5.78 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|