C9H13ClS — CID 134377480
(3E,5Z)-7-chloro-2-methyl-4-methylsulfanylhepta-1,3,5-triene (PubChem CID 134377480) has the molecular formula C9H13ClS and a molecular weight of 188.72 g/mol. Its IUPAC name is (3E,5Z)-7-chloro-2-methyl-4-methylsulfanylhepta-1,3,5-triene.
| Compound Name | (3E,5Z)-7-chloro-2-methyl-4-methylsulfanylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 134377480 |
| Molecular Formula | C9H13ClS |
| Molecular Weight | 188.72 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | (3E,5Z)-7-chloro-2-methyl-4-methylsulfanylhepta-1,3,5-triene |
| SMILES | C=C(C)/C=C(\C=C/CCl)SC |
| InChI | InChI=1S/C9H13ClS/c1-8(2)7-9(11-3)5-4-6-10/h4-5,7H,1,6H2,2-3H3/b5-4-,9-7+ |
| InChIKey | ATUCFBWPGLYKTQ-XEQCUQEESA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.72 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|