C29H34N2O5 — CID 134377662
(1S,2R,3R,3aS)-2-amino-6-(4-aminobutoxy)-8-methoxy-3a-(4-methoxyphenyl)-3-phenyl-1,2,3,8b-tetrahydrocyclopenta[b][1]benzofuran-1-ol (PubChem CID 134377662) has the molecular formula C29H34N2O5 and a molecular weight of 490.60 g/mol. Its IUPAC name is (1S,2R,3R,3aS)-2-amino-6-(4-aminobutoxy)-8-methoxy-3a-(4-methoxyphenyl)-3-phenyl-1,2,3,8b-tetrahydrocyclopenta[b][1]benzofuran-1-ol.
| Compound Name | (1S,2R,3R,3aS)-2-amino-6-(4-aminobutoxy)-8-methoxy-3a-(4-methoxyphenyl)-3-phenyl-1,2,3,8b-tetrahydrocyclopenta[b][1]benzofuran-1-ol |
|---|---|
| PubChem CID | 134377662 |
| Molecular Formula | C29H34N2O5 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | (1S,2R,3R,3aS)-2-amino-6-(4-aminobutoxy)-8-methoxy-3a-(4-methoxyphenyl)-3-phenyl-1,2,3,8b-tetrahydrocyclopenta[b][1]benzofuran-1-ol |
| SMILES | COc1ccc([C@@]23Oc4cc(OCCCCN)cc(OC)c4C2[C@H](O)[C@H](N)[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C29H34N2O5/c1-33-20-12-10-19(11-13-20)29-25(18-8-4-3-5-9-18)27(31)28(32)26(29)24-22(34-2)16-21(17-23(24)36-29)35-15-7-6-14-30/h3-5,8-13,16-17,25-28,32H,6-7,14-15,30-31H2,1-2H3/t25-,26?,27-,28+,29+/m1/s1 |
| InChIKey | LOJUHVGFGSWIPQ-GRIBUZNISA-N |
| XLogP | 3.68 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|