C16H20F3N3 — CID 134377719
(1E,3E)-1-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-methylocta-1,3,5-trien-4-amine (PubChem CID 134377719) has the molecular formula C16H20F3N3 and a molecular weight of 311.35 g/mol. Its IUPAC name is (1E,3E)-1-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-methylocta-1,3,5-trien-4-amine.
| Compound Name | (1E,3E)-1-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-methylocta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 134377719 |
| Molecular Formula | C16H20F3N3 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (1E,3E)-1-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-methylocta-1,3,5-trien-4-amine |
| SMILES | CCC=C/C(=C\C=C\n1nc(C(F)(F)F)cc1C1CC1)NC |
| InChI | InChI=1S/C16H20F3N3/c1-3-4-6-13(20-2)7-5-10-22-14(12-8-9-12)11-15(21-22)16(17,18)19/h4-7,10-12,20H,3,8-9H2,1-2H3/b6-4?,10-5+,13-7+ |
| InChIKey | PJNIIVFUHMUUDO-ABYYNUQGSA-N |
| XLogP | 4.32 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|