C20H30FN3 — CID 134377758
(2E,7E)-6-(5-butan-2-yl-3-cyclopropylpyrazol-1-yl)-7-fluoro-N-methylnona-2,5,7-trien-2-amine (PubChem CID 134377758) has the molecular formula C20H30FN3 and a molecular weight of 331.48 g/mol. Its IUPAC name is (2E,7E)-6-(5-butan-2-yl-3-cyclopropylpyrazol-1-yl)-7-fluoro-N-methylnona-2,5,7-trien-2-amine.
| Compound Name | (2E,7E)-6-(5-butan-2-yl-3-cyclopropylpyrazol-1-yl)-7-fluoro-N-methylnona-2,5,7-trien-2-amine |
|---|---|
| PubChem CID | 134377758 |
| Molecular Formula | C20H30FN3 |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | (2E,7E)-6-(5-butan-2-yl-3-cyclopropylpyrazol-1-yl)-7-fluoro-N-methylnona-2,5,7-trien-2-amine |
| SMILES | C/C=C(/F)C(=CC/C=C(\C)NC)n1nc(C2CC2)cc1C(C)CC |
| InChI | InChI=1S/C20H30FN3/c1-6-14(3)20-13-18(16-11-12-16)23-24(20)19(17(21)7-2)10-8-9-15(4)22-5/h7,9-10,13-14,16,22H,6,8,11-12H2,1-5H3/b15-9+,17-7+,19-10? |
| InChIKey | VIHCWMNCNCOPEL-CSLZLVNFSA-N |
| XLogP | 5.50 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|