About 1-methyl-4H-[1,2,4]triazolo[3,4-c][1,4]benzothiazine
1-methyl-4H-[1,2,4]triazolo[3,4-c][1,4]benzothiazine (PubChem CID 13437776) has the molecular formula C10H9N3S
and a molecular weight of 203.27 g/mol. Its IUPAC name is 1-methyl-4H-[1,2,4]triazolo[3,4-c][1,4]benzothiazine.
Analyze 1-methyl-4H-[1,2,4]triazolo[3,4-c][1,4]benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4H-[1,2,4]triazolo[3,4-c][1,4]benzothiazine?
The IUPAC name of 1-methyl-4H-[1,2,4]triazolo[3,4-c][1,4]benzothiazine (CID 13437776) is 1-methyl-4H-[1,2,4]triazolo[3,4-c][1,4]benzothiazine.
What is the SMILES notation for 1-methyl-4H-[1,2,4]triazolo[3,4-c][1,4]benzothiazine?
The canonical SMILES for 1-methyl-4H-[1,2,4]triazolo[3,4-c][1,4]benzothiazine is Cc1nnc2n1-c1ccccc1SC2.
What is the InChIKey of 1-methyl-4H-[1,2,4]triazolo[3,4-c][1,4]benzothiazine?
The InChIKey is VMXDWLBNYXYBFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3S/c1-7-11-12-10-6-14-9-5-3-2-4-8(9)13(7)10/h2-5H,6H2,1H3.
What are the key properties of 1-methyl-4H-[1,2,4]triazolo[3,4-c][1,4]benzothiazine?
1-methyl-4H-[1,2,4]triazolo[3,4-c][1,4]benzothiazine has a molecular weight of 203.27 g/mol, XLogP of 2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4H-[1,2,4]triazolo[3,4-c][1,4]benzothiazine is sourced from PubChem (CID 13437776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).