C18H14ClF3N2O5S — CID 134378609
5-chloro-2-[(3R)-3-hydroxy-3-(hydroxymethyl)-4-(2,3,4-trifluorophenoxy)pyrrolidin-1-yl]sulfonylbenzonitrile (PubChem CID 134378609) has the molecular formula C18H14ClF3N2O5S and a molecular weight of 462.83 g/mol. Its IUPAC name is 5-chloro-2-[(3R)-3-hydroxy-3-(hydroxymethyl)-4-(2,3,4-trifluorophenoxy)pyrrolidin-1-yl]sulfonylbenzonitrile.
| Compound Name | 5-chloro-2-[(3R)-3-hydroxy-3-(hydroxymethyl)-4-(2,3,4-trifluorophenoxy)pyrrolidin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 134378609 |
| Molecular Formula | C18H14ClF3N2O5S |
| Molecular Weight | 462.83 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | 5-chloro-2-[(3R)-3-hydroxy-3-(hydroxymethyl)-4-(2,3,4-trifluorophenoxy)pyrrolidin-1-yl]sulfonylbenzonitrile |
| SMILES | N#Cc1cc(Cl)ccc1S(=O)(=O)N1CC(Oc2ccc(F)c(F)c2F)[C@](O)(CO)C1 |
| InChI | InChI=1S/C18H14ClF3N2O5S/c19-11-1-4-14(10(5-11)6-23)30(27,28)24-7-15(18(26,8-24)9-25)29-13-3-2-12(20)16(21)17(13)22/h1-5,15,25-26H,7-9H2/t15?,18-/m1/s1 |
| InChIKey | XLEDOOPTHGDFBM-KPMSDPLLSA-N |
| XLogP | 1.80 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.83 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|