About 4-methyl-2,5-dimethylidene-4-[2-[(2-methylpropan-2-yl)oxy]butyl]-1,3-dioxolane
4-methyl-2,5-dimethylidene-4-[2-[(2-methylpropan-2-yl)oxy]butyl]-1,3-dioxolane (PubChem CID 134378901) has the molecular formula C14H24O3
and a molecular weight of 240.34 g/mol. Its IUPAC name is 4-methyl-2,5-dimethylidene-4-[2-[(2-methylpropan-2-yl)oxy]butyl]-1,3-dioxolane.
Molecular Properties
| Compound Name | 4-methyl-2,5-dimethylidene-4-[2-[(2-methylpropan-2-yl)oxy]butyl]-1,3-dioxolane |
| PubChem CID | 134378901 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 4-methyl-2,5-dimethylidene-4-[2-[(2-methylpropan-2-yl)oxy]butyl]-1,3-dioxolane |
| SMILES | C=C1OC(=C)C(C)(CC(CC)OC(C)(C)C)O1 |
| InChI | InChI=1S/C14H24O3/c1-8-12(17-13(4,5)6)9-14(7)10(2)15-11(3)16-14/h12H,2-3,8-9H2,1,4-7H3 |
| InChIKey | NOMBOFOGXDADKJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-2,5-dimethylidene-4-[2-[(2-methylpropan-2-yl)oxy]butyl]-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,5-dimethylidene-4-[2-[(2-methylpropan-2-yl)oxy]butyl]-1,3-dioxolane?
The IUPAC name of 4-methyl-2,5-dimethylidene-4-[2-[(2-methylpropan-2-yl)oxy]butyl]-1,3-dioxolane (CID 134378901) is 4-methyl-2,5-dimethylidene-4-[2-[(2-methylpropan-2-yl)oxy]butyl]-1,3-dioxolane.
What is the SMILES notation for 4-methyl-2,5-dimethylidene-4-[2-[(2-methylpropan-2-yl)oxy]butyl]-1,3-dioxolane?
The canonical SMILES for 4-methyl-2,5-dimethylidene-4-[2-[(2-methylpropan-2-yl)oxy]butyl]-1,3-dioxolane is C=C1OC(=C)C(C)(CC(CC)OC(C)(C)C)O1.
What is the InChIKey of 4-methyl-2,5-dimethylidene-4-[2-[(2-methylpropan-2-yl)oxy]butyl]-1,3-dioxolane?
The InChIKey is NOMBOFOGXDADKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O3/c1-8-12(17-13(4,5)6)9-14(7)10(2)15-11(3)16-14/h12H,2-3,8-9H2,1,4-7H3.
What are the key properties of 4-methyl-2,5-dimethylidene-4-[2-[(2-methylpropan-2-yl)oxy]butyl]-1,3-dioxolane?
4-methyl-2,5-dimethylidene-4-[2-[(2-methylpropan-2-yl)oxy]butyl]-1,3-dioxolane has a molecular weight of 240.34 g/mol, XLogP of 3.76, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,5-dimethylidene-4-[2-[(2-methylpropan-2-yl)oxy]butyl]-1,3-dioxolane is sourced from PubChem (CID 134378901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).