C25H23N3 — CID 134379078
N-[3-[(Z)-1-(methylamino)prop-1-enyl]phenyl]-N-naphthalen-1-ylpyridin-2-amine (PubChem CID 134379078) has the molecular formula C25H23N3 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-[3-[(Z)-1-(methylamino)prop-1-enyl]phenyl]-N-naphthalen-1-ylpyridin-2-amine.
| Compound Name | N-[3-[(Z)-1-(methylamino)prop-1-enyl]phenyl]-N-naphthalen-1-ylpyridin-2-amine |
|---|---|
| PubChem CID | 134379078 |
| Molecular Formula | C25H23N3 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N-[3-[(Z)-1-(methylamino)prop-1-enyl]phenyl]-N-naphthalen-1-ylpyridin-2-amine |
| SMILES | C/C=C(\NC)c1cccc(N(c2ccccn2)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C25H23N3/c1-3-23(26-2)20-12-8-13-21(18-20)28(25-16-6-7-17-27-25)24-15-9-11-19-10-4-5-14-22(19)24/h3-18,26H,1-2H3/b23-3- |
| InChIKey | SDZHLPHLLSJPGA-LNQJRUQSSA-N |
| XLogP | 6.28 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |