C18H26N2O — CID 134379190
(1E,3E)-2-(2,5-dimethylphenyl)-N-methyl-4-morpholin-4-ylpenta-1,3-dien-1-amine (PubChem CID 134379190) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is (1E,3E)-2-(2,5-dimethylphenyl)-N-methyl-4-morpholin-4-ylpenta-1,3-dien-1-amine.
| Compound Name | (1E,3E)-2-(2,5-dimethylphenyl)-N-methyl-4-morpholin-4-ylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 134379190 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | (1E,3E)-2-(2,5-dimethylphenyl)-N-methyl-4-morpholin-4-ylpenta-1,3-dien-1-amine |
| SMILES | CN/C=C(\C=C(/C)N1CCOCC1)c1cc(C)ccc1C |
| InChI | InChI=1S/C18H26N2O/c1-14-5-6-15(2)18(11-14)17(13-19-4)12-16(3)20-7-9-21-10-8-20/h5-6,11-13,19H,7-10H2,1-4H3/b16-12+,17-13+ |
| InChIKey | NSBFVEHANJMRQL-UNZYHPAISA-N |
| XLogP | 3.10 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|