C14H16F2N2 — CID 134379286
N-[(1E,3Z)-2-(2,5-dimethyl-3-pyridinyl)-6,6-difluorohexa-1,3-dienyl]methanimine (PubChem CID 134379286) has the molecular formula C14H16F2N2 and a molecular weight of 250.29 g/mol. Its IUPAC name is N-[(1E,3Z)-2-(2,5-dimethyl-3-pyridinyl)-6,6-difluorohexa-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3Z)-2-(2,5-dimethyl-3-pyridinyl)-6,6-difluorohexa-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 134379286 |
| Molecular Formula | C14H16F2N2 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | N-[(1E,3Z)-2-(2,5-dimethyl-3-pyridinyl)-6,6-difluorohexa-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(\C=C/CC(F)F)c1cc(C)cnc1C |
| InChI | InChI=1S/C14H16F2N2/c1-10-7-13(11(2)18-8-10)12(9-17-3)5-4-6-14(15)16/h4-5,7-9,14H,3,6H2,1-2H3/b5-4-,12-9+ |
| InChIKey | MHGDIAYSEBZPDV-KVWUJKKISA-N |
| XLogP | 3.95 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|