C20H30FN3 — CID 134379338
[(2E,4Z)-6-(dipropylamino)-5-fluoro-4-(2-methylcyclohexa-1,5-dien-1-yl)hexa-2,4-dien-2-yl]cyanamide (PubChem CID 134379338) has the molecular formula C20H30FN3 and a molecular weight of 331.48 g/mol. Its IUPAC name is [(2E,4Z)-6-(dipropylamino)-5-fluoro-4-(2-methylcyclohexa-1,5-dien-1-yl)hexa-2,4-dien-2-yl]cyanamide.
| Compound Name | [(2E,4Z)-6-(dipropylamino)-5-fluoro-4-(2-methylcyclohexa-1,5-dien-1-yl)hexa-2,4-dien-2-yl]cyanamide |
|---|---|
| PubChem CID | 134379338 |
| Molecular Formula | C20H30FN3 |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | [(2E,4Z)-6-(dipropylamino)-5-fluoro-4-(2-methylcyclohexa-1,5-dien-1-yl)hexa-2,4-dien-2-yl]cyanamide |
| SMILES | CCCN(CCC)C/C(F)=C(\C=C(/C)NC#N)C1=C(C)CCC=C1 |
| InChI | InChI=1S/C20H30FN3/c1-5-11-24(12-6-2)14-20(21)19(13-17(4)23-15-22)18-10-8-7-9-16(18)3/h8,10,13,23H,5-7,9,11-12,14H2,1-4H3/b17-13+,20-19- |
| InChIKey | NLBJNRPHOIYNAZ-YWKYIXQJSA-N |
| XLogP | 4.97 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|