C24H37N3 — CID 134379596
(E)-5-cyclohexyl-1-(2,5-dimethylcyclohexa-1,5-dien-1-yl)-3-piperidin-1-ylpent-2-ene-1,4-diimine (PubChem CID 134379596) has the molecular formula C24H37N3 and a molecular weight of 367.58 g/mol. Its IUPAC name is (E)-5-cyclohexyl-1-(2,5-dimethylcyclohexa-1,5-dien-1-yl)-3-piperidin-1-ylpent-2-ene-1,4-diimine.
| Compound Name | (E)-5-cyclohexyl-1-(2,5-dimethylcyclohexa-1,5-dien-1-yl)-3-piperidin-1-ylpent-2-ene-1,4-diimine |
|---|---|
| PubChem CID | 134379596 |
| Molecular Formula | C24H37N3 |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.30 |
| IUPAC Name | (E)-5-cyclohexyl-1-(2,5-dimethylcyclohexa-1,5-dien-1-yl)-3-piperidin-1-ylpent-2-ene-1,4-diimine |
| SMILES | [H]/N=C(/C=C(C(\CC1CCCCC1)=N\[H])/N1CCCCC1)C1=C(C)CCC(C)=C1 |
| InChI | InChI=1S/C24H37N3/c1-18-11-12-19(2)21(15-18)22(25)17-24(27-13-7-4-8-14-27)23(26)16-20-9-5-3-6-10-20/h15,17,20,25-26H,3-14,16H2,1-2H3/b24-17+,25-22-,26-23+ |
| InChIKey | VWPGBUSNOUSBTE-QZWFQUDDSA-N |
| XLogP | 6.42 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|