C20H29N3 — CID 134379605
N-[(E)-[(2E)-1-(2,5-dimethylphenyl)-3-piperidin-1-ylpenta-2,4-dienylidene]amino]-N-methylmethanamine (PubChem CID 134379605) has the molecular formula C20H29N3 and a molecular weight of 311.47 g/mol. Its IUPAC name is N-[(E)-[(2E)-1-(2,5-dimethylphenyl)-3-piperidin-1-ylpenta-2,4-dienylidene]amino]-N-methylmethanamine.
| Compound Name | N-[(E)-[(2E)-1-(2,5-dimethylphenyl)-3-piperidin-1-ylpenta-2,4-dienylidene]amino]-N-methylmethanamine |
|---|---|
| PubChem CID | 134379605 |
| Molecular Formula | C20H29N3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.24 |
| IUPAC Name | N-[(E)-[(2E)-1-(2,5-dimethylphenyl)-3-piperidin-1-ylpenta-2,4-dienylidene]amino]-N-methylmethanamine |
| SMILES | C=C/C(=C\C(=N/N(C)C)c1cc(C)ccc1C)N1CCCCC1 |
| InChI | InChI=1S/C20H29N3/c1-6-18(23-12-8-7-9-13-23)15-20(21-22(4)5)19-14-16(2)10-11-17(19)3/h6,10-11,14-15H,1,7-9,12-13H2,2-5H3/b18-15+,21-20+ |
| InChIKey | OJDLYDRAAJVYHQ-YJHHGKIBSA-N |
| XLogP | 4.12 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|