About 4-[1,2-dimethyl-5-(2-methyl-5-prop-1-en-2-ylphenyl)-2H-pyridin-3-yl]-1,4-oxazepane
4-[1,2-dimethyl-5-(2-methyl-5-prop-1-en-2-ylphenyl)-2H-pyridin-3-yl]-1,4-oxazepane (PubChem CID 134380053) has the molecular formula C22H30N2O
and a molecular weight of 338.50 g/mol. Its IUPAC name is 4-[1,2-dimethyl-5-(2-methyl-5-prop-1-en-2-ylphenyl)-2H-pyridin-3-yl]-1,4-oxazepane.
Molecular Properties
| Compound Name | 4-[1,2-dimethyl-5-(2-methyl-5-prop-1-en-2-ylphenyl)-2H-pyridin-3-yl]-1,4-oxazepane |
| PubChem CID | 134380053 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 4-[1,2-dimethyl-5-(2-methyl-5-prop-1-en-2-ylphenyl)-2H-pyridin-3-yl]-1,4-oxazepane |
| SMILES | C=C(C)c1ccc(C)c(C2=CN(C)C(C)C(N3CCCOCC3)=C2)c1 |
| InChI | InChI=1S/C22H30N2O/c1-16(2)19-8-7-17(3)21(13-19)20-14-22(18(4)23(5)15-20)24-9-6-11-25-12-10-24/h7-8,13-15,18H,1,6,9-12H2,2-5H3 |
| InChIKey | JLOQWGLWAHLNQL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[1,2-dimethyl-5-(2-methyl-5-prop-1-en-2-ylphenyl)-2H-pyridin-3-yl]-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1,2-dimethyl-5-(2-methyl-5-prop-1-en-2-ylphenyl)-2H-pyridin-3-yl]-1,4-oxazepane?
The IUPAC name of 4-[1,2-dimethyl-5-(2-methyl-5-prop-1-en-2-ylphenyl)-2H-pyridin-3-yl]-1,4-oxazepane (CID 134380053) is 4-[1,2-dimethyl-5-(2-methyl-5-prop-1-en-2-ylphenyl)-2H-pyridin-3-yl]-1,4-oxazepane.
What is the SMILES notation for 4-[1,2-dimethyl-5-(2-methyl-5-prop-1-en-2-ylphenyl)-2H-pyridin-3-yl]-1,4-oxazepane?
The canonical SMILES for 4-[1,2-dimethyl-5-(2-methyl-5-prop-1-en-2-ylphenyl)-2H-pyridin-3-yl]-1,4-oxazepane is C=C(C)c1ccc(C)c(C2=CN(C)C(C)C(N3CCCOCC3)=C2)c1.
What is the InChIKey of 4-[1,2-dimethyl-5-(2-methyl-5-prop-1-en-2-ylphenyl)-2H-pyridin-3-yl]-1,4-oxazepane?
The InChIKey is JLOQWGLWAHLNQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30N2O/c1-16(2)19-8-7-17(3)21(13-19)20-14-22(18(4)23(5)15-20)24-9-6-11-25-12-10-24/h7-8,13-15,18H,1,6,9-12H2,2-5H3.
What are the key properties of 4-[1,2-dimethyl-5-(2-methyl-5-prop-1-en-2-ylphenyl)-2H-pyridin-3-yl]-1,4-oxazepane?
4-[1,2-dimethyl-5-(2-methyl-5-prop-1-en-2-ylphenyl)-2H-pyridin-3-yl]-1,4-oxazepane has a molecular weight of 338.50 g/mol, XLogP of 4.31, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1,2-dimethyl-5-(2-methyl-5-prop-1-en-2-ylphenyl)-2H-pyridin-3-yl]-1,4-oxazepane is sourced from PubChem (CID 134380053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).