C8H13NO2 — CID 134380153
(3aR,5R,7aS)-5-hydroxy-2,3,3a,4,5,6,7,7a-octahydroisoindol-1-one (PubChem CID 134380153) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (3aR,5R,7aS)-5-hydroxy-2,3,3a,4,5,6,7,7a-octahydroisoindol-1-one.
| Compound Name | (3aR,5R,7aS)-5-hydroxy-2,3,3a,4,5,6,7,7a-octahydroisoindol-1-one |
|---|---|
| PubChem CID | 134380153 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (3aR,5R,7aS)-5-hydroxy-2,3,3a,4,5,6,7,7a-octahydroisoindol-1-one |
| SMILES | O=C1NC[C@@H]2C[C@H](O)CC[C@H]12 |
| InChI | InChI=1S/C8H13NO2/c10-6-1-2-7-5(3-6)4-9-8(7)11/h5-7,10H,1-4H2,(H,9,11)/t5-,6+,7-/m0/s1 |
| InChIKey | DAEUHLGJMVOGEU-XVMARJQXSA-N |
| XLogP | -0.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |