C11H17NO2 — CID 134380155
(3aR,5R,7aS)-5-hydroxy-2-prop-2-enyl-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one (PubChem CID 134380155) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (3aR,5R,7aS)-5-hydroxy-2-prop-2-enyl-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one.
| Compound Name | (3aR,5R,7aS)-5-hydroxy-2-prop-2-enyl-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 134380155 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (3aR,5R,7aS)-5-hydroxy-2-prop-2-enyl-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one |
| SMILES | C=CCN1C[C@@H]2C[C@H](O)CC[C@@H]2C1=O |
| InChI | InChI=1S/C11H17NO2/c1-2-5-12-7-8-6-9(13)3-4-10(8)11(12)14/h2,8-10,13H,1,3-7H2/t8-,9+,10-/m0/s1 |
| InChIKey | ICOYKIJGYPOEEI-AEJSXWLSSA-N |
| XLogP | 0.79 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|