C12H8F6 — CID 13438016
7,8-bis(trifluoromethyl)tricyclo[4.2.2.02,5]deca-3,7,9-triene (PubChem CID 13438016) has the molecular formula C12H8F6 and a molecular weight of 266.18 g/mol. Its IUPAC name is 7,8-bis(trifluoromethyl)tricyclo[4.2.2.02,5]deca-3,7,9-triene.
| Compound Name | 7,8-bis(trifluoromethyl)tricyclo[4.2.2.02,5]deca-3,7,9-triene |
|---|---|
| PubChem CID | 13438016 |
| Molecular Formula | C12H8F6 |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 7,8-bis(trifluoromethyl)tricyclo[4.2.2.02,5]deca-3,7,9-triene |
| SMILES | FC(F)(F)C1=C(C(F)(F)F)C2C=CC1C1C=CC21 |
| InChI | InChI=1S/C12H8F6/c13-11(14,15)9-7-3-4-8(6-2-1-5(6)7)10(9)12(16,17)18/h1-8H |
| InChIKey | OULXBCHHHQYNNT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|