About (7-cyclopropylimidazo[1,5-a]pyridin-8-yl)-(1-phenylpiperidin-4-yl)methanol
(7-cyclopropylimidazo[1,5-a]pyridin-8-yl)-(1-phenylpiperidin-4-yl)methanol (PubChem CID 134381090) has the molecular formula C22H25N3O
and a molecular weight of 347.46 g/mol. Its IUPAC name is (7-cyclopropylimidazo[1,5-a]pyridin-8-yl)-(1-phenylpiperidin-4-yl)methanol.
Molecular Properties
| Compound Name | (7-cyclopropylimidazo[1,5-a]pyridin-8-yl)-(1-phenylpiperidin-4-yl)methanol |
| PubChem CID | 134381090 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | (7-cyclopropylimidazo[1,5-a]pyridin-8-yl)-(1-phenylpiperidin-4-yl)methanol |
| SMILES | OC(c1c(C2CC2)ccn2cncc12)C1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H25N3O/c26-22(17-8-11-24(12-9-17)18-4-2-1-3-5-18)21-19(16-6-7-16)10-13-25-15-23-14-20(21)25/h1-5,10,13-17,22,26H,6-9,11-12H2 |
| InChIKey | JNTHJVKQXWJABV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 40.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7-cyclopropylimidazo[1,5-a]pyridin-8-yl)-(1-phenylpiperidin-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-cyclopropylimidazo[1,5-a]pyridin-8-yl)-(1-phenylpiperidin-4-yl)methanol?
The IUPAC name of (7-cyclopropylimidazo[1,5-a]pyridin-8-yl)-(1-phenylpiperidin-4-yl)methanol (CID 134381090) is (7-cyclopropylimidazo[1,5-a]pyridin-8-yl)-(1-phenylpiperidin-4-yl)methanol.
What is the SMILES notation for (7-cyclopropylimidazo[1,5-a]pyridin-8-yl)-(1-phenylpiperidin-4-yl)methanol?
The canonical SMILES for (7-cyclopropylimidazo[1,5-a]pyridin-8-yl)-(1-phenylpiperidin-4-yl)methanol is OC(c1c(C2CC2)ccn2cncc12)C1CCN(c2ccccc2)CC1.
What is the InChIKey of (7-cyclopropylimidazo[1,5-a]pyridin-8-yl)-(1-phenylpiperidin-4-yl)methanol?
The InChIKey is JNTHJVKQXWJABV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O/c26-22(17-8-11-24(12-9-17)18-4-2-1-3-5-18)21-19(16-6-7-16)10-13-25-15-23-14-20(21)25/h1-5,10,13-17,22,26H,6-9,11-12H2.
What are the key properties of (7-cyclopropylimidazo[1,5-a]pyridin-8-yl)-(1-phenylpiperidin-4-yl)methanol?
(7-cyclopropylimidazo[1,5-a]pyridin-8-yl)-(1-phenylpiperidin-4-yl)methanol has a molecular weight of 347.46 g/mol, XLogP of 4.16, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-cyclopropylimidazo[1,5-a]pyridin-8-yl)-(1-phenylpiperidin-4-yl)methanol is sourced from PubChem (CID 134381090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).