C23H39N3O — CID 134381120
(4E,6E,7E,9E)-7-ethyl-9-N,4-dimethyl-6-[(Z)-2-morpholin-4-ylbut-2-enylidene]undeca-4,7,9-triene-1,9-diamine (PubChem CID 134381120) has the molecular formula C23H39N3O and a molecular weight of 373.59 g/mol. Its IUPAC name is (4E,6E,7E,9E)-7-ethyl-9-N,4-dimethyl-6-[(Z)-2-morpholin-4-ylbut-2-enylidene]undeca-4,7,9-triene-1,9-diamine.
| Compound Name | (4E,6E,7E,9E)-7-ethyl-9-N,4-dimethyl-6-[(Z)-2-morpholin-4-ylbut-2-enylidene]undeca-4,7,9-triene-1,9-diamine |
|---|---|
| PubChem CID | 134381120 |
| Molecular Formula | C23H39N3O |
| Molecular Weight | 373.59 g/mol |
| Exact Mass | 373.31 |
| IUPAC Name | (4E,6E,7E,9E)-7-ethyl-9-N,4-dimethyl-6-[(Z)-2-morpholin-4-ylbut-2-enylidene]undeca-4,7,9-triene-1,9-diamine |
| SMILES | C/C=C(/C=C(\C=C(/C)CCCN)C(=C/C(=C\C)NC)/CC)N1CCOCC1 |
| InChI | InChI=1S/C23H39N3O/c1-6-20(17-22(7-2)25-5)21(16-19(4)10-9-11-24)18-23(8-3)26-12-14-27-15-13-26/h7-8,16-18,25H,6,9-15,24H2,1-5H3/b19-16+,20-17+,21-18+,22-7+,23-8- |
| InChIKey | MTEGPDHALIMOHR-XKYAULDCSA-N |
| XLogP | 4.29 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.59 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|