C34H14F2N4S2 — CID 134381494
[20-cyanoimino-6,17-bis(4-fluorophenyl)-11,22-dithiahexacyclo[10.10.0.02,10.03,8.013,21.014,19]docosa-1(12),2(10),3(8),4,6,13(21),14(19),15,17-nonaen-9-ylidene]cyanamide (PubChem CID 134381494) has the molecular formula C34H14F2N4S2 and a molecular weight of 580.64 g/mol. Its IUPAC name is [20-cyanoimino-6,17-bis(4-fluorophenyl)-11,22-dithiahexacyclo[10.10.0.02,10.03,8.013,21.014,19]docosa-1(12),2(10),3(8),4,6,13(21),14(19),15,17-nonaen-9-ylidene]cyanamide.
| Compound Name | [20-cyanoimino-6,17-bis(4-fluorophenyl)-11,22-dithiahexacyclo[10.10.0.02,10.03,8.013,21.014,19]docosa-1(12),2(10),3(8),4,6,13(21),14(19),15,17-nonaen-9-ylidene]cyanamide |
|---|---|
| PubChem CID | 134381494 |
| Molecular Formula | C34H14F2N4S2 |
| Molecular Weight | 580.64 g/mol |
| Exact Mass | 580.06 |
| IUPAC Name | [20-cyanoimino-6,17-bis(4-fluorophenyl)-11,22-dithiahexacyclo[10.10.0.02,10.03,8.013,21.014,19]docosa-1(12),2(10),3(8),4,6,13(21),14(19),15,17-nonaen-9-ylidene]cyanamide |
| SMILES | N#C/N=c1/c2cc(-c3ccc(F)cc3)ccc2c2c1sc1c2sc2/c(=N\C#N)c3cc(-c4ccc(F)cc4)ccc3c21 |
| InChI | InChI=1S/C34H14F2N4S2/c35-21-7-1-17(2-8-21)19-5-11-23-25(13-19)29(39-15-37)31-27(23)33-34(41-31)28-24-12-6-20(18-3-9-22(36)10-4-18)14-26(24)30(40-16-38)32(28)42-33/h1-14H/b39-29-,40-30- |
| InChIKey | XUGSFYNWOBJXJG-LDIFZFAOSA-N |
| XLogP | 8.83 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.64 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|