C25H44FN — CID 134381686
(3E,5Z)-N-(9-fluoro-4,9-dimethyldecan-4-yl)-3,4,6-trimethyl-7-methylidenenona-1,3,5-trien-2-amine (PubChem CID 134381686) has the molecular formula C25H44FN and a molecular weight of 377.63 g/mol. Its IUPAC name is (3E,5Z)-N-(9-fluoro-4,9-dimethyldecan-4-yl)-3,4,6-trimethyl-7-methylidenenona-1,3,5-trien-2-amine.
| Compound Name | (3E,5Z)-N-(9-fluoro-4,9-dimethyldecan-4-yl)-3,4,6-trimethyl-7-methylidenenona-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 134381686 |
| Molecular Formula | C25H44FN |
| Molecular Weight | 377.63 g/mol |
| Exact Mass | 377.35 |
| IUPAC Name | (3E,5Z)-N-(9-fluoro-4,9-dimethyldecan-4-yl)-3,4,6-trimethyl-7-methylidenenona-1,3,5-trien-2-amine |
| SMILES | C=C(CC)/C(C)=C\C(C)=C(/C)C(=C)NC(C)(CCC)CCCCC(C)(C)F |
| InChI | InChI=1S/C25H44FN/c1-11-15-25(10,17-14-13-16-24(8,9)26)27-23(7)22(6)21(5)18-20(4)19(3)12-2/h18,27H,3,7,11-17H2,1-2,4-6,8-10H3/b20-18-,22-21+ |
| InChIKey | WYRKLSPDIYEWAX-YALZWYRPSA-N |
| XLogP | 8.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.63 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|