About 2,2-bis(prop-2-enoyloxymethyl)pent-4-enyl prop-2-enoate
2,2-bis(prop-2-enoyloxymethyl)pent-4-enyl prop-2-enoate (PubChem CID 134382271) has the molecular formula C16H20O6
and a molecular weight of 308.33 g/mol. Its IUPAC name is 2,2-bis(prop-2-enoyloxymethyl)pent-4-enyl prop-2-enoate.
Molecular Properties
| Compound Name | 2,2-bis(prop-2-enoyloxymethyl)pent-4-enyl prop-2-enoate |
| PubChem CID | 134382271 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2,2-bis(prop-2-enoyloxymethyl)pent-4-enyl prop-2-enoate |
| SMILES | C=CCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C |
| InChI | InChI=1S/C16H20O6/c1-5-9-16(10-20-13(17)6-2,11-21-14(18)7-3)12-22-15(19)8-4/h5-8H,1-4,9-12H2 |
| InChIKey | SACKFLJKERYCPJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(prop-2-enoyloxymethyl)pent-4-enyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(prop-2-enoyloxymethyl)pent-4-enyl prop-2-enoate?
The IUPAC name of 2,2-bis(prop-2-enoyloxymethyl)pent-4-enyl prop-2-enoate (CID 134382271) is 2,2-bis(prop-2-enoyloxymethyl)pent-4-enyl prop-2-enoate.
What is the SMILES notation for 2,2-bis(prop-2-enoyloxymethyl)pent-4-enyl prop-2-enoate?
The canonical SMILES for 2,2-bis(prop-2-enoyloxymethyl)pent-4-enyl prop-2-enoate is C=CCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C.
What is the InChIKey of 2,2-bis(prop-2-enoyloxymethyl)pent-4-enyl prop-2-enoate?
The InChIKey is SACKFLJKERYCPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O6/c1-5-9-16(10-20-13(17)6-2,11-21-14(18)7-3)12-22-15(19)8-4/h5-8H,1-4,9-12H2.
What are the key properties of 2,2-bis(prop-2-enoyloxymethyl)pent-4-enyl prop-2-enoate?
2,2-bis(prop-2-enoyloxymethyl)pent-4-enyl prop-2-enoate has a molecular weight of 308.33 g/mol, XLogP of 1.74, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(prop-2-enoyloxymethyl)pent-4-enyl prop-2-enoate is sourced from PubChem (CID 134382271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).