C24H28N2O2S — CID 134382409
4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-methoxypiperidin-2-yl]benzenecarbothioic S-acid (PubChem CID 134382409) has the molecular formula C24H28N2O2S and a molecular weight of 408.57 g/mol. Its IUPAC name is 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-methoxypiperidin-2-yl]benzenecarbothioic S-acid.
| Compound Name | 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-methoxypiperidin-2-yl]benzenecarbothioic S-acid |
|---|---|
| PubChem CID | 134382409 |
| Molecular Formula | C24H28N2O2S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-methoxypiperidin-2-yl]benzenecarbothioic S-acid |
| SMILES | COC1CCN(Cc2c(C)cc(C)c3[nH]ccc23)C(c2ccc(C(=O)S)cc2)C1 |
| InChI | InChI=1S/C24H28N2O2S/c1-15-12-16(2)23-20(8-10-25-23)21(15)14-26-11-9-19(28-3)13-22(26)17-4-6-18(7-5-17)24(27)29/h4-8,10,12,19,22,25H,9,11,13-14H2,1-3H3,(H,27,29) |
| InChIKey | ZMYQRFQXKVFZQF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|