C23H32N2 — CID 134382774
N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-(2-piperidin-2-ylethyl)-2,3-dihydro-1H-inden-2-amine (PubChem CID 134382774) has the molecular formula C23H32N2 and a molecular weight of 336.52 g/mol. Its IUPAC name is N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-(2-piperidin-2-ylethyl)-2,3-dihydro-1H-inden-2-amine.
| Compound Name | N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-(2-piperidin-2-ylethyl)-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 134382774 |
| Molecular Formula | C23H32N2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-(2-piperidin-2-ylethyl)-2,3-dihydro-1H-inden-2-amine |
| SMILES | C=C/C=C(\C=C/C)N(CCC1CCCCN1)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C23H32N2/c1-3-9-22(10-4-2)25(16-14-21-13-7-8-15-24-21)23-17-19-11-5-6-12-20(19)18-23/h3-6,9-12,21,23-24H,1,7-8,13-18H2,2H3/b10-4-,22-9+ |
| InChIKey | MSIJWIXIXUPUIP-IPWWSSOJSA-N |
| XLogP | 4.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|