About 1'-propan-2-ylspiro[1,2-dihydroindole-3,4'-piperidine]-2-ol
1'-propan-2-ylspiro[1,2-dihydroindole-3,4'-piperidine]-2-ol (PubChem CID 134383306) has the molecular formula C15H22N2O
and a molecular weight of 246.35 g/mol. Its IUPAC name is 1'-propan-2-ylspiro[1,2-dihydroindole-3,4'-piperidine]-2-ol.
Molecular Properties
| Compound Name | 1'-propan-2-ylspiro[1,2-dihydroindole-3,4'-piperidine]-2-ol |
| PubChem CID | 134383306 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 1'-propan-2-ylspiro[1,2-dihydroindole-3,4'-piperidine]-2-ol |
| SMILES | CC(C)N1CCC2(CC1)c1ccccc1NC2O |
| InChI | InChI=1S/C15H22N2O/c1-11(2)17-9-7-15(8-10-17)12-5-3-4-6-13(12)16-14(15)18/h3-6,11,14,16,18H,7-10H2,1-2H3 |
| InChIKey | OZFYVGJTZHGTMJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1'-propan-2-ylspiro[1,2-dihydroindole-3,4'-piperidine]-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-propan-2-ylspiro[1,2-dihydroindole-3,4'-piperidine]-2-ol?
The IUPAC name of 1'-propan-2-ylspiro[1,2-dihydroindole-3,4'-piperidine]-2-ol (CID 134383306) is 1'-propan-2-ylspiro[1,2-dihydroindole-3,4'-piperidine]-2-ol.
What is the SMILES notation for 1'-propan-2-ylspiro[1,2-dihydroindole-3,4'-piperidine]-2-ol?
The canonical SMILES for 1'-propan-2-ylspiro[1,2-dihydroindole-3,4'-piperidine]-2-ol is CC(C)N1CCC2(CC1)c1ccccc1NC2O.
What is the InChIKey of 1'-propan-2-ylspiro[1,2-dihydroindole-3,4'-piperidine]-2-ol?
The InChIKey is OZFYVGJTZHGTMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O/c1-11(2)17-9-7-15(8-10-17)12-5-3-4-6-13(12)16-14(15)18/h3-6,11,14,16,18H,7-10H2,1-2H3.
What are the key properties of 1'-propan-2-ylspiro[1,2-dihydroindole-3,4'-piperidine]-2-ol?
1'-propan-2-ylspiro[1,2-dihydroindole-3,4'-piperidine]-2-ol has a molecular weight of 246.35 g/mol, XLogP of 2.17, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-propan-2-ylspiro[1,2-dihydroindole-3,4'-piperidine]-2-ol is sourced from PubChem (CID 134383306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).