C26H39F2N3S — CID 134383351
N'-butan-2-yl-3-[4-[(4,4-difluorocyclohexyl)amino]sulfanyl-2-methylcyclohex-2-en-1-yl]-2,6-dimethylbenzenecarboximidamide (PubChem CID 134383351) has the molecular formula C26H39F2N3S and a molecular weight of 463.68 g/mol. Its IUPAC name is N'-butan-2-yl-3-[4-[(4,4-difluorocyclohexyl)amino]sulfanyl-2-methylcyclohex-2-en-1-yl]-2,6-dimethylbenzenecarboximidamide.
| Compound Name | N'-butan-2-yl-3-[4-[(4,4-difluorocyclohexyl)amino]sulfanyl-2-methylcyclohex-2-en-1-yl]-2,6-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 134383351 |
| Molecular Formula | C26H39F2N3S |
| Molecular Weight | 463.68 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | N'-butan-2-yl-3-[4-[(4,4-difluorocyclohexyl)amino]sulfanyl-2-methylcyclohex-2-en-1-yl]-2,6-dimethylbenzenecarboximidamide |
| SMILES | CCC(C)/N=C(\N)c1c(C)ccc(C2CCC(SNC3CCC(F)(F)CC3)C=C2C)c1C |
| InChI | InChI=1S/C26H39F2N3S/c1-6-18(4)30-25(29)24-16(2)7-9-23(19(24)5)22-10-8-21(15-17(22)3)32-31-20-11-13-26(27,28)14-12-20/h7,9,15,18,20-22,31H,6,8,10-14H2,1-5H3,(H2,29,30) |
| InChIKey | FHBCYQIZDTXUAD-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.68 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|