C10H15F3O6S — CID 134383366
3,3,3-trifluoro-2-(4-hydroxycyclohexanecarbonyl)oxypropane-1-sulfonic acid (PubChem CID 134383366) has the molecular formula C10H15F3O6S and a molecular weight of 320.29 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(4-hydroxycyclohexanecarbonyl)oxypropane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-(4-hydroxycyclohexanecarbonyl)oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 134383366 |
| Molecular Formula | C10H15F3O6S |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 3,3,3-trifluoro-2-(4-hydroxycyclohexanecarbonyl)oxypropane-1-sulfonic acid |
| SMILES | O=C(OC(CS(=O)(=O)O)C(F)(F)F)C1CCC(O)CC1 |
| InChI | InChI=1S/C10H15F3O6S/c11-10(12,13)8(5-20(16,17)18)19-9(15)6-1-3-7(14)4-2-6/h6-8,14H,1-5H2,(H,16,17,18) |
| InChIKey | LPRYMUOKJVKPME-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|