C14H21NO2S — CID 13438347
3-(4-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)thiophene-2-carbaldehyde (PubChem CID 13438347) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 3-(4-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)thiophene-2-carbaldehyde.
| Compound Name | 3-(4-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 13438347 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 3-(4-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)thiophene-2-carbaldehyde |
| SMILES | CC1(C)CC(O)(c2ccsc2C=O)CC(C)(C)N1 |
| InChI | InChI=1S/C14H21NO2S/c1-12(2)8-14(17,9-13(3,4)15-12)10-5-6-18-11(10)7-16/h5-7,15,17H,8-9H2,1-4H3 |
| InChIKey | MZLQWZHLWHJYRP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|