C11H16F5N — CID 134384141
1-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)piperidine (PubChem CID 134384141) has the molecular formula C11H16F5N and a molecular weight of 257.25 g/mol. Its IUPAC name is 1-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)piperidine.
| Compound Name | 1-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)piperidine |
|---|---|
| PubChem CID | 134384141 |
| Molecular Formula | C11H16F5N |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 1-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)piperidine |
| SMILES | C=C(C)C(F)(F)C(F)C(F)(F)N1CCCCC1 |
| InChI | InChI=1S/C11H16F5N/c1-8(2)10(13,14)9(12)11(15,16)17-6-4-3-5-7-17/h9H,1,3-7H2,2H3 |
| InChIKey | CTVOCIHYDAPRCM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|