C9H12F5N — CID 134384144
1-(1,1,2,3,3-pentafluoropent-4-enyl)pyrrolidine (PubChem CID 134384144) has the molecular formula C9H12F5N and a molecular weight of 229.19 g/mol. Its IUPAC name is 1-(1,1,2,3,3-pentafluoropent-4-enyl)pyrrolidine.
| Compound Name | 1-(1,1,2,3,3-pentafluoropent-4-enyl)pyrrolidine |
|---|---|
| PubChem CID | 134384144 |
| Molecular Formula | C9H12F5N |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 1-(1,1,2,3,3-pentafluoropent-4-enyl)pyrrolidine |
| SMILES | C=CC(F)(F)C(F)C(F)(F)N1CCCC1 |
| InChI | InChI=1S/C9H12F5N/c1-2-8(11,12)7(10)9(13,14)15-5-3-4-6-15/h2,7H,1,3-6H2 |
| InChIKey | MBQGNPAFYJWYGW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|