C12H12F11NO — CID 134384145
4-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)-2,6-bis(trifluoromethyl)morpholine (PubChem CID 134384145) has the molecular formula C12H12F11NO and a molecular weight of 395.21 g/mol. Its IUPAC name is 4-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)-2,6-bis(trifluoromethyl)morpholine.
| Compound Name | 4-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)-2,6-bis(trifluoromethyl)morpholine |
|---|---|
| PubChem CID | 134384145 |
| Molecular Formula | C12H12F11NO |
| Molecular Weight | 395.21 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 4-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)-2,6-bis(trifluoromethyl)morpholine |
| SMILES | C=C(C)C(F)(F)C(F)C(F)(F)N1CC(C(F)(F)F)OC(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H12F11NO/c1-5(2)9(14,15)8(13)12(22,23)24-3-6(10(16,17)18)25-7(4-24)11(19,20)21/h6-8H,1,3-4H2,2H3 |
| InChIKey | TXAGTPLCKDSMTR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.21 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|