C12H12F11N — CID 134384149
1-(1,1,2,3,3-pentafluoropent-4-enyl)-3,5-bis(trifluoromethyl)piperidine (PubChem CID 134384149) has the molecular formula C12H12F11N and a molecular weight of 379.21 g/mol. Its IUPAC name is 1-(1,1,2,3,3-pentafluoropent-4-enyl)-3,5-bis(trifluoromethyl)piperidine.
| Compound Name | 1-(1,1,2,3,3-pentafluoropent-4-enyl)-3,5-bis(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 134384149 |
| Molecular Formula | C12H12F11N |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 1-(1,1,2,3,3-pentafluoropent-4-enyl)-3,5-bis(trifluoromethyl)piperidine |
| SMILES | C=CC(F)(F)C(F)C(F)(F)N1CC(C(F)(F)F)CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H12F11N/c1-2-9(14,15)8(13)12(22,23)24-4-6(10(16,17)18)3-7(5-24)11(19,20)21/h2,6-8H,1,3-5H2 |
| InChIKey | QDZZNTAOBFAWKL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|