C12H15F8N — CID 134384155
1-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)-4-(trifluoromethyl)piperidine (PubChem CID 134384155) has the molecular formula C12H15F8N and a molecular weight of 325.24 g/mol. Its IUPAC name is 1-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)-4-(trifluoromethyl)piperidine.
| Compound Name | 1-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 134384155 |
| Molecular Formula | C12H15F8N |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 1-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)-4-(trifluoromethyl)piperidine |
| SMILES | C=C(C)C(F)(F)C(F)C(F)(F)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H15F8N/c1-7(2)10(14,15)9(13)12(19,20)21-5-3-8(4-6-21)11(16,17)18/h8-9H,1,3-6H2,2H3 |
| InChIKey | UNYHSLGLOBLOJR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|