C11H14F8N2 — CID 134384158
1-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)-4-(trifluoromethyl)piperazine (PubChem CID 134384158) has the molecular formula C11H14F8N2 and a molecular weight of 326.23 g/mol. Its IUPAC name is 1-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)-4-(trifluoromethyl)piperazine.
| Compound Name | 1-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)-4-(trifluoromethyl)piperazine |
|---|---|
| PubChem CID | 134384158 |
| Molecular Formula | C11H14F8N2 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 1-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)-4-(trifluoromethyl)piperazine |
| SMILES | C=C(C)C(F)(F)C(F)C(F)(F)N1CCN(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H14F8N2/c1-7(2)9(13,14)8(12)10(15,16)20-3-5-21(6-4-20)11(17,18)19/h8H,1,3-6H2,2H3 |
| InChIKey | SRBAGZBPWSMENW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|