C14H20F3NS — CID 134384244
(2E,4E)-3-[(E)-prop-1-enyl]sulfanyl-N-[(E)-4,4,4-trifluorobut-1-enyl]hepta-2,4-dien-4-amine (PubChem CID 134384244) has the molecular formula C14H20F3NS and a molecular weight of 291.38 g/mol. Its IUPAC name is (2E,4E)-3-[(E)-prop-1-enyl]sulfanyl-N-[(E)-4,4,4-trifluorobut-1-enyl]hepta-2,4-dien-4-amine.
| Compound Name | (2E,4E)-3-[(E)-prop-1-enyl]sulfanyl-N-[(E)-4,4,4-trifluorobut-1-enyl]hepta-2,4-dien-4-amine |
|---|---|
| PubChem CID | 134384244 |
| Molecular Formula | C14H20F3NS |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | (2E,4E)-3-[(E)-prop-1-enyl]sulfanyl-N-[(E)-4,4,4-trifluorobut-1-enyl]hepta-2,4-dien-4-amine |
| SMILES | C/C=C/SC(=C/C)/C(=C\CC)N/C=C/CC(F)(F)F |
| InChI | InChI=1S/C14H20F3NS/c1-4-8-12(13(6-3)19-11-5-2)18-10-7-9-14(15,16)17/h5-8,10-11,18H,4,9H2,1-3H3/b10-7+,11-5+,12-8+,13-6+ |
| InChIKey | PCDLJKGYCGBSBM-HLVHXQGKSA-N |
| XLogP | 5.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|