About 6-chloro-3-ethyl-2,4-dihydro-1,3-benzoxazine
6-chloro-3-ethyl-2,4-dihydro-1,3-benzoxazine (PubChem CID 134384301) has the molecular formula C10H12ClNO
and a molecular weight of 197.67 g/mol. Its IUPAC name is 6-chloro-3-ethyl-2,4-dihydro-1,3-benzoxazine.
Molecular Properties
| Compound Name | 6-chloro-3-ethyl-2,4-dihydro-1,3-benzoxazine |
| PubChem CID | 134384301 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.67 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 6-chloro-3-ethyl-2,4-dihydro-1,3-benzoxazine |
| SMILES | CCN1COc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C10H12ClNO/c1-2-12-6-8-5-9(11)3-4-10(8)13-7-12/h3-5H,2,6-7H2,1H3 |
| InChIKey | KNNLEWFRFFEWIT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.67 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-3-ethyl-2,4-dihydro-1,3-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-ethyl-2,4-dihydro-1,3-benzoxazine?
The IUPAC name of 6-chloro-3-ethyl-2,4-dihydro-1,3-benzoxazine (CID 134384301) is 6-chloro-3-ethyl-2,4-dihydro-1,3-benzoxazine.
What is the SMILES notation for 6-chloro-3-ethyl-2,4-dihydro-1,3-benzoxazine?
The canonical SMILES for 6-chloro-3-ethyl-2,4-dihydro-1,3-benzoxazine is CCN1COc2ccc(Cl)cc2C1.
What is the InChIKey of 6-chloro-3-ethyl-2,4-dihydro-1,3-benzoxazine?
The InChIKey is KNNLEWFRFFEWIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNO/c1-2-12-6-8-5-9(11)3-4-10(8)13-7-12/h3-5H,2,6-7H2,1H3.
What are the key properties of 6-chloro-3-ethyl-2,4-dihydro-1,3-benzoxazine?
6-chloro-3-ethyl-2,4-dihydro-1,3-benzoxazine has a molecular weight of 197.67 g/mol, XLogP of 2.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-ethyl-2,4-dihydro-1,3-benzoxazine is sourced from PubChem (CID 134384301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).