C31H34O9S2 — CID 134384514
7-[2-[2-(adamantane-1-carbonyloxy)-4-methyl-5-sulfophenyl]propyl]-4-hydroxynaphthalene-1-sulfonic acid (PubChem CID 134384514) has the molecular formula C31H34O9S2 and a molecular weight of 614.74 g/mol. Its IUPAC name is 7-[2-[2-(adamantane-1-carbonyloxy)-4-methyl-5-sulfophenyl]propyl]-4-hydroxynaphthalene-1-sulfonic acid.
| Compound Name | 7-[2-[2-(adamantane-1-carbonyloxy)-4-methyl-5-sulfophenyl]propyl]-4-hydroxynaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 134384514 |
| Molecular Formula | C31H34O9S2 |
| Molecular Weight | 614.74 g/mol |
| Exact Mass | 614.16 |
| IUPAC Name | 7-[2-[2-(adamantane-1-carbonyloxy)-4-methyl-5-sulfophenyl]propyl]-4-hydroxynaphthalene-1-sulfonic acid |
| SMILES | Cc1cc(OC(=O)C23CC4CC(CC(C4)C2)C3)c(C(C)Cc2ccc3c(O)ccc(S(=O)(=O)O)c3c2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C31H34O9S2/c1-17(7-19-3-4-23-25(12-19)28(41(34,35)36)6-5-26(23)32)24-13-29(42(37,38)39)18(2)8-27(24)40-30(33)31-14-20-9-21(15-31)11-22(10-20)16-31/h3-6,8,12-13,17,20-22,32H,7,9-11,14-16H2,1-2H3,(H,34,35,36)(H,37,38,39) |
| InChIKey | PVWIZILDDYDQJE-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 155.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.74 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|