About 7-chloro-4-fluoro-6,11-dihydrobenzo[c][1]benzothiepine
7-chloro-4-fluoro-6,11-dihydrobenzo[c][1]benzothiepine (PubChem CID 134384970) has the molecular formula C14H10ClFS
and a molecular weight of 264.75 g/mol. Its IUPAC name is 7-chloro-4-fluoro-6,11-dihydrobenzo[c][1]benzothiepine.
Molecular Properties
| Compound Name | 7-chloro-4-fluoro-6,11-dihydrobenzo[c][1]benzothiepine |
| PubChem CID | 134384970 |
| Molecular Formula | C14H10ClFS |
| Molecular Weight | 264.75 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 7-chloro-4-fluoro-6,11-dihydrobenzo[c][1]benzothiepine |
| SMILES | Fc1cccc2c1SCc1c(Cl)cccc1C2 |
| InChI | InChI=1S/C14H10ClFS/c15-12-5-1-3-9-7-10-4-2-6-13(16)14(10)17-8-11(9)12/h1-6H,7-8H2 |
| InChIKey | BPDLXQWKROSRMQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.75 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-chloro-4-fluoro-6,11-dihydrobenzo[c][1]benzothiepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-4-fluoro-6,11-dihydrobenzo[c][1]benzothiepine?
The IUPAC name of 7-chloro-4-fluoro-6,11-dihydrobenzo[c][1]benzothiepine (CID 134384970) is 7-chloro-4-fluoro-6,11-dihydrobenzo[c][1]benzothiepine.
What is the SMILES notation for 7-chloro-4-fluoro-6,11-dihydrobenzo[c][1]benzothiepine?
The canonical SMILES for 7-chloro-4-fluoro-6,11-dihydrobenzo[c][1]benzothiepine is Fc1cccc2c1SCc1c(Cl)cccc1C2.
What is the InChIKey of 7-chloro-4-fluoro-6,11-dihydrobenzo[c][1]benzothiepine?
The InChIKey is BPDLXQWKROSRMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClFS/c15-12-5-1-3-9-7-10-4-2-6-13(16)14(10)17-8-11(9)12/h1-6H,7-8H2.
What are the key properties of 7-chloro-4-fluoro-6,11-dihydrobenzo[c][1]benzothiepine?
7-chloro-4-fluoro-6,11-dihydrobenzo[c][1]benzothiepine has a molecular weight of 264.75 g/mol, XLogP of 4.68, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-4-fluoro-6,11-dihydrobenzo[c][1]benzothiepine is sourced from PubChem (CID 134384970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).