About (4E)-6-ethoxy-N-ethyl-5-methyl-3-methylidenehepta-4,6-dien-2-imine
(4E)-6-ethoxy-N-ethyl-5-methyl-3-methylidenehepta-4,6-dien-2-imine (PubChem CID 134385499) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is (4E)-6-ethoxy-N-ethyl-5-methyl-3-methylidenehepta-4,6-dien-2-imine.
Molecular Properties
| Compound Name | (4E)-6-ethoxy-N-ethyl-5-methyl-3-methylidenehepta-4,6-dien-2-imine |
| PubChem CID | 134385499 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (4E)-6-ethoxy-N-ethyl-5-methyl-3-methylidenehepta-4,6-dien-2-imine |
| SMILES | C=C(OCC)/C(C)=C/C(=C)/C(C)=N/CC |
| InChI | InChI=1S/C13H21NO/c1-7-14-12(5)10(3)9-11(4)13(6)15-8-2/h9H,3,6-8H2,1-2,4-5H3/b11-9+,14-12+ |
| InChIKey | COGDCORYOMTEMY-HUJVCGDBSA-N |
| XLogP | 3.52 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-6-ethoxy-N-ethyl-5-methyl-3-methylidenehepta-4,6-dien-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-6-ethoxy-N-ethyl-5-methyl-3-methylidenehepta-4,6-dien-2-imine?
The IUPAC name of (4E)-6-ethoxy-N-ethyl-5-methyl-3-methylidenehepta-4,6-dien-2-imine (CID 134385499) is (4E)-6-ethoxy-N-ethyl-5-methyl-3-methylidenehepta-4,6-dien-2-imine.
What is the SMILES notation for (4E)-6-ethoxy-N-ethyl-5-methyl-3-methylidenehepta-4,6-dien-2-imine?
The canonical SMILES for (4E)-6-ethoxy-N-ethyl-5-methyl-3-methylidenehepta-4,6-dien-2-imine is C=C(OCC)/C(C)=C/C(=C)/C(C)=N/CC.
What is the InChIKey of (4E)-6-ethoxy-N-ethyl-5-methyl-3-methylidenehepta-4,6-dien-2-imine?
The InChIKey is COGDCORYOMTEMY-HUJVCGDBSA-N. The full InChI is InChI=1S/C13H21NO/c1-7-14-12(5)10(3)9-11(4)13(6)15-8-2/h9H,3,6-8H2,1-2,4-5H3/b11-9+,14-12+.
What are the key properties of (4E)-6-ethoxy-N-ethyl-5-methyl-3-methylidenehepta-4,6-dien-2-imine?
(4E)-6-ethoxy-N-ethyl-5-methyl-3-methylidenehepta-4,6-dien-2-imine has a molecular weight of 207.32 g/mol, XLogP of 3.52, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-6-ethoxy-N-ethyl-5-methyl-3-methylidenehepta-4,6-dien-2-imine is sourced from PubChem (CID 134385499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).