About 6-cyclopentyliminocyclohexa-2,4-dien-1-one
6-cyclopentyliminocyclohexa-2,4-dien-1-one (PubChem CID 134385694) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 6-cyclopentyliminocyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 6-cyclopentyliminocyclohexa-2,4-dien-1-one |
| PubChem CID | 134385694 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 6-cyclopentyliminocyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=C/C1=N\C1CCCC1 |
| InChI | InChI=1S/C11H13NO/c13-11-8-4-3-7-10(11)12-9-5-1-2-6-9/h3-4,7-9H,1-2,5-6H2/b12-10+ |
| InChIKey | RHFBMGUFQAXIHK-ZRDIBKRKSA-N |
| XLogP | 2.07 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-cyclopentyliminocyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopentyliminocyclohexa-2,4-dien-1-one?
The IUPAC name of 6-cyclopentyliminocyclohexa-2,4-dien-1-one (CID 134385694) is 6-cyclopentyliminocyclohexa-2,4-dien-1-one.
What is the SMILES notation for 6-cyclopentyliminocyclohexa-2,4-dien-1-one?
The canonical SMILES for 6-cyclopentyliminocyclohexa-2,4-dien-1-one is O=C1C=CC=C/C1=N\C1CCCC1.
What is the InChIKey of 6-cyclopentyliminocyclohexa-2,4-dien-1-one?
The InChIKey is RHFBMGUFQAXIHK-ZRDIBKRKSA-N. The full InChI is InChI=1S/C11H13NO/c13-11-8-4-3-7-10(11)12-9-5-1-2-6-9/h3-4,7-9H,1-2,5-6H2/b12-10+.
What are the key properties of 6-cyclopentyliminocyclohexa-2,4-dien-1-one?
6-cyclopentyliminocyclohexa-2,4-dien-1-one has a molecular weight of 175.23 g/mol, XLogP of 2.07, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopentyliminocyclohexa-2,4-dien-1-one is sourced from PubChem (CID 134385694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).