About cyclohexa-1,4-diene-1-carboxamide
cyclohexa-1,4-diene-1-carboxamide (PubChem CID 13438613) has the molecular formula C7H9NO
and a molecular weight of 123.15 g/mol. Its IUPAC name is cyclohexa-1,4-diene-1-carboxamide.
Molecular Properties
| Compound Name | cyclohexa-1,4-diene-1-carboxamide |
| PubChem CID | 13438613 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | cyclohexa-1,4-diene-1-carboxamide |
| SMILES | NC(=O)C1=CCC=CC1 |
| InChI | InChI=1S/C7H9NO/c8-7(9)6-4-2-1-3-5-6/h1-2,5H,3-4H2,(H2,8,9) |
| InChIKey | OMDZDTUDUQXMGU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-1,4-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,4-diene-1-carboxamide?
The IUPAC name of cyclohexa-1,4-diene-1-carboxamide (CID 13438613) is cyclohexa-1,4-diene-1-carboxamide.
What is the SMILES notation for cyclohexa-1,4-diene-1-carboxamide?
The canonical SMILES for cyclohexa-1,4-diene-1-carboxamide is NC(=O)C1=CCC=CC1.
What is the InChIKey of cyclohexa-1,4-diene-1-carboxamide?
The InChIKey is OMDZDTUDUQXMGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO/c8-7(9)6-4-2-1-3-5-6/h1-2,5H,3-4H2,(H2,8,9).
What are the key properties of cyclohexa-1,4-diene-1-carboxamide?
cyclohexa-1,4-diene-1-carboxamide has a molecular weight of 123.15 g/mol, XLogP of 0.75, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,4-diene-1-carboxamide is sourced from PubChem (CID 13438613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).