About N,N-dimethylcyclohexa-1,4-diene-1-carboxamide
N,N-dimethylcyclohexa-1,4-diene-1-carboxamide (PubChem CID 13438614) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is N,N-dimethylcyclohexa-1,4-diene-1-carboxamide.
Molecular Properties
| Compound Name | N,N-dimethylcyclohexa-1,4-diene-1-carboxamide |
| PubChem CID | 13438614 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | N,N-dimethylcyclohexa-1,4-diene-1-carboxamide |
| SMILES | CN(C)C(=O)C1=CCC=CC1 |
| InChI | InChI=1S/C9H13NO/c1-10(2)9(11)8-6-4-3-5-7-8/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | NADUCUVOSGNXRF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylcyclohexa-1,4-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylcyclohexa-1,4-diene-1-carboxamide?
The IUPAC name of N,N-dimethylcyclohexa-1,4-diene-1-carboxamide (CID 13438614) is N,N-dimethylcyclohexa-1,4-diene-1-carboxamide.
What is the SMILES notation for N,N-dimethylcyclohexa-1,4-diene-1-carboxamide?
The canonical SMILES for N,N-dimethylcyclohexa-1,4-diene-1-carboxamide is CN(C)C(=O)C1=CCC=CC1.
What is the InChIKey of N,N-dimethylcyclohexa-1,4-diene-1-carboxamide?
The InChIKey is NADUCUVOSGNXRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-10(2)9(11)8-6-4-3-5-7-8/h3-4,7H,5-6H2,1-2H3.
What are the key properties of N,N-dimethylcyclohexa-1,4-diene-1-carboxamide?
N,N-dimethylcyclohexa-1,4-diene-1-carboxamide has a molecular weight of 151.21 g/mol, XLogP of 1.35, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylcyclohexa-1,4-diene-1-carboxamide is sourced from PubChem (CID 13438614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).