C12H18FN — CID 134386180
(2R)-2-[(3E,5E)-5-fluorohepta-1,3,5-trien-3-yl]-1-methylpyrrolidine (PubChem CID 134386180) has the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. Its IUPAC name is (2R)-2-[(3E,5E)-5-fluorohepta-1,3,5-trien-3-yl]-1-methylpyrrolidine.
| Compound Name | (2R)-2-[(3E,5E)-5-fluorohepta-1,3,5-trien-3-yl]-1-methylpyrrolidine |
|---|---|
| PubChem CID | 134386180 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | (2R)-2-[(3E,5E)-5-fluorohepta-1,3,5-trien-3-yl]-1-methylpyrrolidine |
| SMILES | C=C/C(=C\C(F)=C/C)[C@H]1CCCN1C |
| InChI | InChI=1S/C12H18FN/c1-4-10(9-11(13)5-2)12-7-6-8-14(12)3/h4-5,9,12H,1,6-8H2,2-3H3/b10-9+,11-5+/t12-/m1/s1 |
| InChIKey | IZUHNJOAITVZTQ-BNQVIZRSSA-N |
| XLogP | 3.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|